Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-2Fe-2S-Ferredoxins == * common-name: ** a reduced [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == * 2.8.1.6...")
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Reduced-2Fe-2S-Ferredoxins ==
+
== Metabolite MANNITOL-1P ==
 
* common-name:
 
* common-name:
** a reduced [2fe-2s] ferredoxin
+
** d-mannitol 1-phosphate
 +
* smiles:
 +
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
 +
* inchi-key:
 +
** gactwzzmvmukng-kvtdhhqdsa-l
 +
* molecular-weight:
 +
** 260.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
* [[RXN-11586]]
+
* [[MANNPDEHYDROG-RXN]]
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-949]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MANNPDEHYDROG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced [2fe-2s] ferredoxin}}
+
{{#set: common-name=d-mannitol 1-phosphate}}
 +
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}
 +
{{#set: molecular-weight=260.137}}

Latest revision as of 11:11, 18 March 2021

Metabolite MANNITOL-1P

  • common-name:
    • d-mannitol 1-phosphate
  • smiles:
    • c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
  • inchi-key:
    • gactwzzmvmukng-kvtdhhqdsa-l
  • molecular-weight:
    • 260.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality