Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * smiles: ** c(cc(=o)c(=o)[o-])cc(=o)[o-] * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * mole...")
(Created page with "Category:metabolite == Metabolite Reduced-2Fe-2S-Ferredoxins == * common-name: ** a reduced [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == * 2.8.1.6...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2K-ADIPATE ==
+
== Metabolite Reduced-2Fe-2S-Ferredoxins ==
 
* common-name:
 
* common-name:
** 2-oxoadipate
+
** a reduced [2fe-2s] ferredoxin
* smiles:
 
** c(cc(=o)c(=o)[o-])cc(=o)[o-]
 
* inchi-key:
 
** fgsbnbbhozhubo-uhfffaoysa-l
 
* molecular-weight:
 
** 158.11
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* [[2.8.1.6-RXN]]
 +
* [[RXN-11586]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN0-949]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-oxoadipate}}
+
{{#set: common-name=a reduced [2fe-2s] ferredoxin}}
{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
 
{{#set: molecular-weight=158.11}}
 

Revision as of 15:25, 5 January 2021

Metabolite Reduced-2Fe-2S-Ferredoxins

  • common-name:
    • a reduced [2fe-2s] ferredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.