Difference between revisions of "MANNOSE-6P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc == * common-name: ** a [heparan]-n-acetyl-α-d-glucosamine == Reaction(s) known to consume the compound == == Reacti...") |
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MANNOSE-6P == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-mannopyranose 6-phosphate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) | ||
+ | * inchi-key: | ||
+ | ** nbschqhzlsjfnq-pqmkyfcfsa-l | ||
+ | * molecular-weight: | ||
+ | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] |
+ | * [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]] | ||
+ | * [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]] | ||
+ | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-mannopyranose 6-phosphate}} |
+ | {{#set: inchi-key=inchikey=nbschqhzlsjfnq-pqmkyfcfsa-l}} | ||
+ | {{#set: molecular-weight=258.121}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite MANNOSE-6P
- common-name:
- α-d-mannopyranose 6-phosphate
- smiles:
- c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- nbschqhzlsjfnq-pqmkyfcfsa-l
- molecular-weight:
- 258.121
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.
- MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.
- MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.
- PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.