|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-54 RXN3O-54] == | + | == Metabolite CPD-8291 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 2-hexaprenyl-6-methoxy-1,4-benzoquinol methyltransferase | + | ** 1-18:1-2-18:1-phosphatidylethanolamine |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.1.1.201 ec-2.1.1.201] | + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop(occ[n+])([o-])=o)=o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
| + | ** mwrbnpkjoowzpw-nyvomtagsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 744.043 |
| − | * Gene: [[SJ07072]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-15036]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-15067]] |
| − | * Gene: [[SJ00609]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-15036]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ02842]]
| + | {{#set: common-name=1-18:1-2-18:1-phosphatidylethanolamine}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=mwrbnpkjoowzpw-nyvomtagsa-n}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=744.043}} |
| − | * Gene: [[SJ11757]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ20751]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ02693]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ11297]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7230]], ubiquinol-6 biosynthesis from 4-aminobenzoate (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7230 PWY-7230] | |
| − | ** '''3''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7233]], ubiquinol-6 bypass biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7233 PWY-7233] | |
| − | ** '''3''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY3O-19]], ubiquinol-6 biosynthesis from 4-hydroxybenzoate (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-19 PWY3O-19]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R04990 R04990]
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28286 28286]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=2-hexaprenyl-6-methoxy-1,4-benzoquinol methyltransferase}} | |
| − | {{#set: ec-number=ec-2.1.1.201}} | |
| − | {{#set: nb gene associated=7}} | |
| − | {{#set: nb pathway associated=3}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
