Difference between revisions of "MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] == * common-na...")
 
(Created page with "Category:pathway == Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS == * taxonomic-range: ** tax-2759 * common-name: ** protein n-glycosylation initial phase (eukaryotic) ==...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] ==
+
== Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
−
** (2r,3s)-3-isopropylmalate
+
** protein n-glycosylation initial phase (eukaryotic)
−
* smiles:
+
== Reaction(s) found ==
−
** cc(c)c(c([o-])=o)c(c([o-])=o)o
+
* [[2.4.1.117-RXN]]
−
* inchi-key:
+
* [[2.4.1.119-RXN]]
−
** rnqhmtfbussbjq-crclsjgqsa-l
+
* [[2.4.1.141-RXN]]
−
* molecular-weight:
+
* [[2.4.1.142-RXN]]
−
** 174.153
+
* [[2.4.1.83-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[2.7.8.15-RXN]]
−
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
* [[RXN-5462]]
−
* [[IMDH]]
+
* [[RXN-5463]]
−
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
+
* [[RXN-5464]]
−
* [[RXN-13158]]
+
* [[RXN-5466]]
−
* [[RXN-13163]]
+
* [[RXN-5467]]
−
* [[RXN-8991]]
+
* [[RXN-5468]]
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-5469]]
−
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
* [[RXN-5470]]
−
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
+
* [[RXN-5471]]
−
* [[RXN-13163]]
+
* [[RXN-5472]]
−
* [[RXN-8991]]
+
== Reaction(s) not found ==
−
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-16592 RXN-16592]
−
{{#set: common-name=(2r,3s)-3-isopropylmalate}}
+
* [NoneRXN-16593 RXN-16593]
−
{{#set: inchi-key=inchikey=rnqhmtfbussbjq-crclsjgqsa-l}}
+
* [NoneRXN-16594 RXN-16594]
−
{{#set: molecular-weight=174.153}}
+
{{#set: taxonomic-range=tax-2759}}
 +
{{#set: common-name=protein n-glycosylation initial phase (eukaryotic)}}
 +
{{#set: nb reaction found=16}}
 +
{{#set: completion rate=0.84}}
 +
{{#set: nb total reaction=19}}

Latest revision as of 10:59, 18 March 2021

Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS

  • taxonomic-range:
    • tax-2759
  • common-name:
    • protein n-glycosylation initial phase (eukaryotic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16592 RXN-16592]
  • [NoneRXN-16593 RXN-16593]
  • [NoneRXN-16594 RXN-16594]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS&oldid=131295"