Difference between revisions of "MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11875 CPD-11875] == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+]...")
(Created page with "Category:pathway == Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS == * taxonomic-range: ** tax-2759 * common-name: ** protein n-glycosylation initial phase (eukaryotic) ==...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11875 CPD-11875] ==
+
== Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** normetanephrine
+
** protein n-glycosylation initial phase (eukaryotic)
* smiles:
+
== Reaction(s) found ==
** coc1(=c(o)c=cc(c(o)c[n+])=c1)
+
* [[2.4.1.117-RXN]]
* inchi-key:
+
* [[2.4.1.119-RXN]]
** ynyaywlbahxhll-qmmmgpobsa-o
+
* [[2.4.1.141-RXN]]
* molecular-weight:
+
* [[2.4.1.142-RXN]]
** 184.214
+
* [[2.4.1.83-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[2.7.8.15-RXN]]
* [[RXN-10910]]
+
* [[RXN-5462]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-5463]]
== Reaction(s) of unknown directionality ==
+
* [[RXN-5464]]
{{#set: common-name=normetanephrine}}
+
* [[RXN-5466]]
{{#set: inchi-key=inchikey=ynyaywlbahxhll-qmmmgpobsa-o}}
+
* [[RXN-5467]]
{{#set: molecular-weight=184.214}}
+
* [[RXN-5468]]
 +
* [[RXN-5469]]
 +
* [[RXN-5470]]
 +
* [[RXN-5471]]
 +
* [[RXN-5472]]
 +
== Reaction(s) not found ==
 +
* [NoneRXN-16592 RXN-16592]
 +
* [NoneRXN-16593 RXN-16593]
 +
* [NoneRXN-16594 RXN-16594]
 +
{{#set: taxonomic-range=tax-2759}}
 +
{{#set: common-name=protein n-glycosylation initial phase (eukaryotic)}}
 +
{{#set: nb reaction found=16}}
 +
{{#set: completion rate=0.84}}
 +
{{#set: nb total reaction=19}}

Latest revision as of 10:59, 18 March 2021

Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS

  • taxonomic-range:
    • tax-2759
  • common-name:
    • protein n-glycosylation initial phase (eukaryotic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16592 RXN-16592]
  • [NoneRXN-16593 RXN-16593]
  • [NoneRXN-16594 RXN-16594]