Difference between revisions of "MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=b-Keto-cis-D5-dodecenoyl-ACPs b-Keto-cis-D5-dodecenoyl-ACPs] == * common-name: ** a (5z)-3-oxo-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11875 CPD-11875] == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11875 CPD-11875] == |
* common-name: | * common-name: | ||
| − | ** | + | ** normetanephrine |
| + | * smiles: | ||
| + | ** coc1(=c(o)c=cc(c(o)c[n+])=c1) | ||
| + | * inchi-key: | ||
| + | ** ynyaywlbahxhll-qmmmgpobsa-o | ||
| + | * molecular-weight: | ||
| + | ** 184.214 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10910]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=normetanephrine}} |
| + | {{#set: inchi-key=inchikey=ynyaywlbahxhll-qmmmgpobsa-o}} | ||
| + | {{#set: molecular-weight=184.214}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-11875
- common-name:
- normetanephrine
- smiles:
- coc1(=c(o)c=cc(c(o)c[n+])=c1)
- inchi-key:
- ynyaywlbahxhll-qmmmgpobsa-o
- molecular-weight:
- 184.214
