Difference between revisions of "MAP-Kinase-L-Phosphothreonine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...")
(Created page with "Category:metabolite == Metabolite CPD-5846 == * common-name: ** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate * smiles: ** cc(c)cccc(c)[ch]4(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13227 ==
+
== Metabolite CPD-5846 ==
 
* common-name:
 
* common-name:
** n,n',n''-triacetylchitotriose
+
** 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
+
** cc(c)cccc(c)[ch]4(cc[ch]3(c(c)(cc[ch]2(c(=cc[ch]1(c(c)(c([o-])=o)c(ccc(c)12)o))3))4))
 
* inchi-key:
 
* inchi-key:
** wzzvuhwlnmnwlw-mewklcdlsa-n
+
** uqfzktihsicspg-dshyqqbwsa-m
 
* molecular-weight:
 
* molecular-weight:
** 627.598
+
** 443.688
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.170-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12623]]
+
* [[1.1.1.170-RXN]]
* [[RXN-12624]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n,n',n''-triacetylchitotriose}}
+
{{#set: common-name=3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate}}
{{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}}
+
{{#set: inchi-key=inchikey=uqfzktihsicspg-dshyqqbwsa-m}}
{{#set: molecular-weight=627.598}}
+
{{#set: molecular-weight=443.688}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-5846

  • common-name:
    • 3β-hydroxy-4β-methyl-5α-cholest-7-ene-4α-carboxylate
  • smiles:
    • cc(c)cccc(c)[ch]4(cc[ch]3(c(c)(cc[ch]2(c(=cc[ch]1(c(c)(c([o-])=o)c(ccc(c)12)o))3))4))
  • inchi-key:
    • uqfzktihsicspg-dshyqqbwsa-m
  • molecular-weight:
    • 443.688

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality