Difference between revisions of "MAP-Kinase-L-Phosphothreonine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Phosphothreonine == * common-name: ** a [mitogen-activated protein kinase] l-threonine phosphate == Reaction(s) known to con...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MAP-Kinase-L-Phosphothreonine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [mitogen-activated protein kinase] l-threonine phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.7.12.2-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.12.2-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [mitogen-activated protein kinase] l-threonine phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite MAP-Kinase-L-Phosphothreonine
- common-name:
- a [mitogen-activated protein kinase] l-threonine phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase] l-threonine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
