Difference between revisions of "MAP-Kinase-L-Phosphothreonine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Purine-Ribonucleosides == * common-name: ** a purine ribonucleoside == Reaction(s) known to consume the compound == * PNP-RXN * PUR...") |
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FMNH2 == |
* common-name: | * common-name: | ||
| − | ** | + | ** fmnh2 |
| + | * smiles: | ||
| + | ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) | ||
| + | * inchi-key: | ||
| + | ** ytnixzgthtvjbw-scrdcrapsa-l | ||
| + | * molecular-weight: | ||
| + | ** 456.348 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9510]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9510]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=fmnh2}} |
| + | {{#set: inchi-key=inchikey=ytnixzgthtvjbw-scrdcrapsa-l}} | ||
| + | {{#set: molecular-weight=456.348}} | ||
Revision as of 14:57, 5 January 2021
Contents
Metabolite FMNH2
- common-name:
- fmnh2
- smiles:
- cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3)))
- inchi-key:
- ytnixzgthtvjbw-scrdcrapsa-l
- molecular-weight:
- 456.348
