Difference between revisions of "MAP-Kinase-L-Phosphothreonine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Ubiquitin-activating-protein-E1-L-cys == * common-name: ** an [e1 ubiquitin-activating enzyme]-l-cysteine == Reaction(s) known to consume...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ubiquitin-activating-protein-E1-L-cys == |
* common-name: | * common-name: | ||
| − | ** | + | ** an [e1 ubiquitin-activating enzyme]-l-cysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15565]] |
| + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15556]] |
| + | * [[RXN-15563]] | ||
| + | * [[RXN-15565]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an [e1 ubiquitin-activating enzyme]-l-cysteine}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite Ubiquitin-activating-protein-E1-L-cys
- common-name:
- an [e1 ubiquitin-activating enzyme]-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [e1 ubiquitin-activating enzyme]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
