Difference between revisions of "MAPKK-Ser-or-Thr-phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-8132 == * common-name: ** thiophenol * smiles: ** c1(c=cc(=cc=1)[s-]) * inchi-key: ** rmvrsndyefqclf-uhfffaoysa-m * molecular-weight:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8132 == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiophenol |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(c=cc(=cc=1)[s-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rmvrsndyefqclf-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 109.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13726]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiophenol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rmvrsndyefqclf-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=109.165}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-8132
- common-name:
- thiophenol
- smiles:
- c1(c=cc(=cc=1)[s-])
- inchi-key:
- rmvrsndyefqclf-uhfffaoysa-m
- molecular-weight:
- 109.165
