Difference between revisions of "MAPKK-Ser-or-Thr-phosphate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18532 == * common-name: ** (r)-β-hydroxy-l-kynurenine * smiles: ** c([o-])(=o)c([n+])c(o)c(=o)c1(=c(n)c=cc=c1) * inchi-key: ** m...") |
(Created page with "Category:metabolite == Metabolite MAPKK-Ser-or-Thr-phosphate == * common-name: ** a [map kinase kinase] (l-serine/l-threonine) phosphate == Reaction(s) known to consume th...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MAPKK-Ser-or-Thr-phosphate == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** a [map kinase kinase] (l-serine/l-threonine) phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.11.25-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.11.25-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=a [map kinase kinase] (l-serine/l-threonine) phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite MAPKK-Ser-or-Thr-phosphate
- common-name:
- a [map kinase kinase] (l-serine/l-threonine) phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [map kinase kinase] (l-serine/l-threonine) phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
