Difference between revisions of "MAPKK-Ser-or-Thr-phosphate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...")
(Created page with "Category:metabolite == Metabolite MAPKK-Ser-or-Thr-phosphate == * common-name: ** a [map kinase kinase] (l-serine/l-threonine) phosphate == Reaction(s) known to consume th...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13004 ==
+
== Metabolite MAPKK-Ser-or-Thr-phosphate ==
 
* common-name:
 
* common-name:
** angiotensin i
+
** a [map kinase kinase] (l-serine/l-threonine) phosphate
* smiles:
 
** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
 
* inchi-key:
 
** orwyrwwvdcyomk-hbzpzaiksa-n
 
* molecular-weight:
 
** 1296.491
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.25-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.4.23.15-RXN]]
+
* [[2.7.11.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=angiotensin i}}
+
{{#set: common-name=a [map kinase kinase] (l-serine/l-threonine) phosphate}}
{{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}}
 
{{#set: molecular-weight=1296.491}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite MAPKK-Ser-or-Thr-phosphate

  • common-name:
    • a [map kinase kinase] (l-serine/l-threonine) phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [map kinase kinase] (l-serine/l-threonine) phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.