Difference between revisions of "MELIBIOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12232 == * transcription-direction: ** positive * right-end-position: ** 121703 * left-end-position: ** 100518 * centisome-position: ** 13.141360...")
(Created page with "Category:metabolite == Metabolite MELIBIOSE == * common-name: ** melibiose * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o * inchi-key: ** dlrvvldznnycbx-zzfzym...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12232 ==
+
== Metabolite MELIBIOSE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** melibiose
−
* right-end-position:
+
* smiles:
−
** 121703
+
** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o
−
* left-end-position:
+
* inchi-key:
−
** 100518
+
** dlrvvldznnycbx-zzfzymbesa-n
−
* centisome-position:
+
* molecular-weight:
−
** 13.141360   
+
** 342.299
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ALPHAGALACTOSID-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN1F-20]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=melibiose}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dlrvvldznnycbx-zzfzymbesa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=342.299}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5531]]
 
−
** '''4''' reactions found over '''9''' reactions in the full pathway
 
−
* [[CHLOROPHYLL-SYN]]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7159]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=121703}}
 
−
{{#set: left-end-position=100518}}
 
−
{{#set: centisome-position=13.141360    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite MELIBIOSE

  • common-name:
    • melibiose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o
  • inchi-key:
    • dlrvvldznnycbx-zzfzymbesa-n
  • molecular-weight:
    • 342.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MELIBIOSE&oldid=136661"