Difference between revisions of "MENAQUINONESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * common-name: ** 3-oxopentanoyl-coa * smiles: ** ccc(=o)cc(=o)sccnc(=o...")
(Created page with "Category:pathway == Pathway MENAQUINONESYN-PWY == * taxonomic-range: ** tax-2157 ** tax-2 * common-name: ** menaquinol-8 biosynthesis == Reaction(s) found == * ADOMET-DM...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Pathway MENAQUINONESYN-PWY ==
 +
* taxonomic-range:
 +
** tax-2157
 +
** tax-2
 
* common-name:
 
* common-name:
** 3-oxopentanoyl-coa
+
** menaquinol-8 biosynthesis
* smiles:
+
== Reaction(s) found ==
** ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wioqnwtzboqteu-zmhdxicwsa-j
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2157}}
** 861.604
+
{{#set: common-name=menaquinol-8 biosynthesis}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-12561]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
* [[RXN-12560]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-oxopentanoyl-coa}}
 
{{#set: inchi-key=inchikey=wioqnwtzboqteu-zmhdxicwsa-j}}
 
{{#set: molecular-weight=861.604}}
 

Latest revision as of 10:59, 18 March 2021

Pathway MENAQUINONESYN-PWY

  • taxonomic-range:
    • tax-2157
    • tax-2
  • common-name:
    • menaquinol-8 biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present