Difference between revisions of "MENAQUINONESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * common-name: ** β-d-ribosylnicotinate * smiles: ** c(o)c1(c(o)c(o)...")
(Created page with "Category:pathway == Pathway PWY-6917 == * taxonomic-range: ** tax-33090 * common-name: ** vernolate biosynthesis iii == Reaction(s) found == * LINOLEOYL-RXN * RXN-84...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] ==
+
== Pathway PWY-6917 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** β-d-ribosylnicotinate
+
** vernolate biosynthesis iii
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
+
* [[LINOLEOYL-RXN]]
* inchi-key:
+
* [[RXN-8497]]
** pueddpcucprqny-zyuzmqfosa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-16219 RXN-16219]
** 255.227
+
{{#set: taxonomic-range=tax-33090}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=vernolate biosynthesis iii}}
* [[RXN-8443]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
* [[RXN-14227]]
+
{{#set: nb total reaction=3}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-d-ribosylnicotinate}}
 
{{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}}
 
{{#set: molecular-weight=255.227}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6917

  • taxonomic-range:
    • tax-33090
  • common-name:
    • vernolate biosynthesis iii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16219 RXN-16219]