|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13404 RXN-13404] == | + | == Metabolite MESO-DIAMINOPIMELATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** sarcosine n-methyltransferase | + | ** meso-diaminopimelate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.1.1.156 ec-2.1.1.156] | + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[GLY]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 2 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DIMETHYL-GLYCINE]][c] '''+''' 2 [[PROTON]][c]
| + | ** gmkmezvlhjarhf-sydprgilsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 190.199 |
| − | * Gene: [[SJ12128]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | * [[DIAMINOPIMDECARB-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
| − | * Gene: [[SJ18177]] | + | * [[DIAMINOPIMEPIM-RXN]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-14246]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ14716]]
| + | * [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]] |
| − | ** Category: [[annotation]] | + | * [[DIAMINOPIMEPIM-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | * [[RXN-14246]] |
| − | * Gene: [[SJ12119]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=meso-diaminopimelate}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}} |
| − | * Gene: [[SJ03081]]
| + | {{#set: molecular-weight=190.199}} |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11087]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ02539]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ10116]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ02540]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ12116]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ12118]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R10060 R10060]
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32466 32466]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=sarcosine n-methyltransferase}} | |
| − | {{#set: ec-number=ec-2.1.1.156}} | |
| − | {{#set: nb gene associated=11}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
