Difference between revisions of "MESO-DIAMINOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14791 RXN-14791] == * direction: ** left-to-right * common-name: ** enoyl-coa hydratase ** tran...")
 
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * smiles: ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o * inchi-key: ** gmkmezv...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14791 RXN-14791] ==
+
== Metabolite MESO-DIAMINOPIMELATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** enoyl-coa hydratase
+
** meso-diaminopimelate
−
** trans--2-enoyl-coa hydratase 2
+
* smiles:
−
* ec-number:
+
** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
−
** [http://enzyme.expasy.org/EC/4.2.1.119 ec-4.2.1.119]
+
* inchi-key:
−
== Reaction formula ==
+
** gmkmezvlhjarhf-sydprgilsa-n
−
* 1 [[CPD-15661]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-15662]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 190.199
−
* Gene: [[SJ04769]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[DIAMINOPIMDECARB-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
−
* Gene: [[SJ03584]]
+
* [[DIAMINOPIMEPIM-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-14246]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
−
* [[PWY-7339]], 10-trans-heptadecenoyl-CoA degradation (MFE-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7339 PWY-7339]
+
* [[DIAMINOPIMEPIM-RXN]]
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-14246]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=meso-diaminopimelate}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=190.199}}
−
{{#set: common-name=enoyl-coa hydratase|trans--2-enoyl-coa hydratase 2}}
 
−
{{#set: ec-number=ec-4.2.1.119}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite MESO-DIAMINOPIMELATE

  • common-name:
    • meso-diaminopimelate
  • smiles:
    • c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
  • inchi-key:
    • gmkmezvlhjarhf-sydprgilsa-n
  • molecular-weight:
    • 190.199

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MESO-DIAMINOPIMELATE&oldid=138995"