Difference between revisions of "MET"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-6P == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite MET == * common-name: ** l-methionine * smiles: ** csccc([n+])c([o-])=o * inchi-key: ** ffearjckvfrzrr-bypyzucnsa-n * molecular-weight: *...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MANNOSE-6P ==
+
== Metabolite MET ==
 
* common-name:
 
* common-name:
** α-d-mannopyranose 6-phosphate
+
** l-methionine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
+
** csccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** nbschqhzlsjfnq-pqmkyfcfsa-l
+
** ffearjckvfrzrr-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 149.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
* [[HOMOCYSMET-RXN]]
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-14147]]
 +
* [[RXN-16165]]
 +
* [[RXN0-6948]]
 +
* [[S-ADENMETSYN-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
+
* [[1.8.4.14-RXN]]
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
+
* [[2.1.1.5-RXN]]
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
+
* [[2.8.1.6-RXN]]
 +
* [[3.4.11.18-RXN]]
 +
* [[HEMN-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
* [[HOMOCYSMETB12-RXN-HOMO-CYS/5-METHYL-THF//MET/THF.31.]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[MMUM-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 +
* [[RXN-11319]]
 +
* [[RXN-11586]]
 +
* [[RXN-14147]]
 +
* [[RXN-14480]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN-17473]]
 +
* [[RXN-17873]]
 +
* [[RXN-17874]]
 +
* [[RXN-17875]]
 +
* [[RXN-17876]]
 +
* [[RXN-17877]]
 +
* [[RXN-17878]]
 +
* [[RXN-8340]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-6974]]
 +
* [[RXN0-6985]]
 +
* [[RXN0-949]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=&alpha;-d-mannopyranose 6-phosphate}}
+
{{#set: common-name=l-methionine}}
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-pqmkyfcfsa-l}}
+
{{#set: inchi-key=inchikey=ffearjckvfrzrr-bypyzucnsa-n}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=149.207}}

Latest revision as of 11:16, 18 March 2021