Difference between revisions of "METH-ACETATE-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13404 CPD-13404] == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurated-Sulfur-Acceptors Sulfurated-Sulfur-Acceptors] == * common-name: ** a sulfurated [sul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13404 CPD-13404] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurated-Sulfur-Acceptors Sulfurated-Sulfur-Acceptors] ==
 
* common-name:
 
* common-name:
** l-alanyl-l-aspartate
+
** a sulfurated [sulfur carrier]
* smiles:
 
** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
 
* inchi-key:
 
** xaewtdmgfghwfk-imjsidkusa-m
 
* molecular-weight:
 
** 203.174
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6975]]
+
* [[2.8.1.6-RXN]]
 +
* [[RXN-12587]]
 +
* [[RXN-14480]]
 +
* [[RXN-14950]]
 +
* [[RXN-14957]]
 +
* [[RXN-14959]]
 +
* [[RXN-17472]]
 +
* [[RXN0-5063]]
 +
* [[RXN0-6359]]
 +
* [[RXN0-949]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12587]]
 +
* [[RXN-12588]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-aspartate}}
+
{{#set: common-name=a sulfurated [sulfur carrier]}}
{{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}}
 
{{#set: molecular-weight=203.174}}
 

Revision as of 09:22, 27 August 2019

Metabolite Sulfurated-Sulfur-Acceptors

  • common-name:
    • a sulfurated [sulfur carrier]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a sulfurated [sulfur carrier" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.