Difference between revisions of "METH-ACETATE-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTINE DIPHTINE] == * common-name: ** a diphthine-[translation elongation factor 2] == Reacti...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13404 CPD-13404] == * common-name: ** l-alanyl-l-aspartate * smiles: ** cc([n+])c(nc(cc(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13404 CPD-13404] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-aspartate |
| + | * smiles: | ||
| + | ** cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o | ||
| + | * inchi-key: | ||
| + | ** xaewtdmgfghwfk-imjsidkusa-m | ||
| + | * molecular-weight: | ||
| + | ** 203.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6975]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-aspartate}} |
| + | {{#set: inchi-key=inchikey=xaewtdmgfghwfk-imjsidkusa-m}} | ||
| + | {{#set: molecular-weight=203.174}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13404
- common-name:
- l-alanyl-l-aspartate
- smiles:
- cc([n+])c(nc(cc(=o)[o-])c(=o)[o-])=o
- inchi-key:
- xaewtdmgfghwfk-imjsidkusa-m
- molecular-weight:
- 203.174
