Difference between revisions of "METHACRYLYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine32 == * common-name: ** a pseudouridine32 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite METHACRYLYL-COA == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite METHACRYLYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** methylacrylyl-coa |
+ | * smiles: | ||
+ | ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | ||
+ | * inchi-key: | ||
+ | ** npalueycdzwbov-ndzskpawsa-j | ||
+ | * molecular-weight: | ||
+ | ** 831.577 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[METHYLACYLYLCOA-HYDROXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[MCDH]] |
+ | * [[METHYLACYLYLCOA-HYDROXY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=methylacrylyl-coa}} |
+ | {{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}} | ||
+ | {{#set: molecular-weight=831.577}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite METHACRYLYL-COA
- common-name:
- methylacrylyl-coa
- smiles:
- c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- npalueycdzwbov-ndzskpawsa-j
- molecular-weight:
- 831.577