Difference between revisions of "METHACRYLYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02097 == * transcription-direction: ** positive * right-end-position: ** 260196 * left-end-position: ** 226837 * centisome-position: ** 41.735188...")
 
(Created page with "Category:metabolite == Metabolite METHACRYLYL-COA == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02097 ==
+
== Metabolite METHACRYLYL-COA ==
* transcription-direction:
+
* common-name:
** positive
+
** methylacrylyl-coa
* right-end-position:
+
* smiles:
** 260196
+
** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
* left-end-position:
+
* inchi-key:
** 226837
+
** npalueycdzwbov-ndzskpawsa-j
* centisome-position:
+
* molecular-weight:
** 41.735188   
+
** 831.577
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DISULFOXRED-RXN]]
+
* [[MCDH]]
** Category: [[annotation]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-982]]
+
{{#set: common-name=methylacrylyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=831.577}}
== Pathway(s) associated ==
 
* [[PWY-4621]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-4202]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=260196}}
 
{{#set: left-end-position=226837}}
 
{{#set: centisome-position=41.735188    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite METHACRYLYL-COA

  • common-name:
    • methylacrylyl-coa
  • smiles:
    • c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • npalueycdzwbov-ndzskpawsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality