Difference between revisions of "METHACRYLYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15368 == * common-name: ** 3-oxo-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
(Created page with "Category:metabolite == Metabolite METHACRYLYL-COA == * common-name: ** methylacrylyl-coa * smiles: ** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15368 ==
+
== Metabolite METHACRYLYL-COA ==
 
* common-name:
 
* common-name:
** 3-oxo-lesqueroloyl-coa
+
** methylacrylyl-coa
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** nqxrrzbozbkgiu-mhaufedzsa-j
+
** npalueycdzwbov-ndzskpawsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1085.989
+
** 831.577
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14493]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14492]]
+
* [[MCDH]]
 +
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-lesqueroloyl-coa}}
+
{{#set: common-name=methylacrylyl-coa}}
{{#set: inchi-key=inchikey=nqxrrzbozbkgiu-mhaufedzsa-j}}
+
{{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}}
{{#set: molecular-weight=1085.989}}
+
{{#set: molecular-weight=831.577}}

Latest revision as of 11:13, 18 March 2021

Metabolite METHACRYLYL-COA

  • common-name:
    • methylacrylyl-coa
  • smiles:
    • c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • npalueycdzwbov-ndzskpawsa-j
  • molecular-weight:
    • 831.577

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality