Difference between revisions of "METHYL-GLYOXAL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] == * direction: ** left-to-right * common-name: ** dopamine oxidase * ec-numbe...")
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] ==
+
== Metabolite THZ-P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** dopamine oxidase
+
** 4-methyl-5-(2-phosphooxyethyl)thiazole
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.4 ec-1.4.3.4]
+
** cc1(n=csc(ccop([o-])(=o)[o-])=1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[DOPAMINE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[34-DIHYDROXYPHENYLACETALDEHYDE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
** ocymerzcmyjqqo-uhfffaoysa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07831]]
+
** 221.167
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[THI-P-SYN-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY6666-2]], dopamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2]
+
* [[THIAZOLSYN3-RXN]]
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-7431]], aromatic biogenic amine degradation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431]
+
{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=221.167}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27947 27947]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04300 R04300]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=dopamine oxidase}}
 
−
{{#set: ec-number=ec-1.4.3.4}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite THZ-P

  • common-name:
    • 4-methyl-5-(2-phosphooxyethyl)thiazole
  • smiles:
    • cc1(n=csc(ccop([o-])(=o)[o-])=1)
  • inchi-key:
    • ocymerzcmyjqqo-uhfffaoysa-l
  • molecular-weight:
    • 221.167

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=METHYL-GLYOXAL&oldid=47911"