Difference between revisions of "METHYLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...") |
(Created page with "Category:metabolite == Metabolite METHYLAMINE == * common-name: ** methylamine * smiles: ** c[n+] * inchi-key: ** bavyzaluxzfzlv-uhfffaoysa-o * molecular-weight: ** 32.065...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite METHYLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** methylamine |
* smiles: | * smiles: | ||
| − | ** | + | ** c[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bavyzaluxzfzlv-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 32.065 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10908]] |
| + | * [[RXN-10913]] | ||
| + | * [[RXN-8673]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methylamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bavyzaluxzfzlv-uhfffaoysa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=32.065}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite METHYLAMINE
- common-name:
- methylamine
- smiles:
- c[n+]
- inchi-key:
- bavyzaluxzfzlv-uhfffaoysa-o
- molecular-weight:
- 32.065
