Difference between revisions of "METHYLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FAD == * common-name: ** fad * smiles: ** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=n...")
(Created page with "Category:metabolite == Metabolite METHYLAMINE == * common-name: ** methylamine * smiles: ** c[n+] * inchi-key: ** bavyzaluxzfzlv-uhfffaoysa-o * molecular-weight: ** 32.065...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FAD ==
+
== Metabolite METHYLAMINE ==
 
* common-name:
 
* common-name:
** fad
+
** methylamine
 
* smiles:
 
* smiles:
** cc6(=c(c)c=c5(c(n=c1(c(=o)[n-]c(=o)n=c1n(cc(c(o)c(o)cop(op([o-])(occ4(c(o)c(o)c(n3(c=nc2(c(n)=nc=nc=23)))o4))=o)([o-])=o)o)5))=c6))
+
** c[n+]
 
* inchi-key:
 
* inchi-key:
** imgvnjnccgxbhd-uybvjogssa-k
+
** bavyzaluxzfzlv-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 782.533
+
** 32.065
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOA120OR]]
 
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[FAD-PYROPHOSPHATASE-RXN]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-11695]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOAD1f]]
+
* [[RXN-10908]]
* [[FAD-PYROPHOSPHATASE-RXN]]
+
* [[RXN-10913]]
* [[FADSYN-RXN]]
+
* [[RXN-8673]]
* [[PPCOAOm]]
 
* [[RXN-11695]]
 
* [[RXN-14264]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fad}}
+
{{#set: common-name=methylamine}}
{{#set: inchi-key=inchikey=imgvnjnccgxbhd-uybvjogssa-k}}
+
{{#set: inchi-key=inchikey=bavyzaluxzfzlv-uhfffaoysa-o}}
{{#set: molecular-weight=782.533}}
+
{{#set: molecular-weight=32.065}}

Latest revision as of 11:15, 18 March 2021

Metabolite METHYLAMINE

  • common-name:
    • methylamine
  • smiles:
    • c[n+]
  • inchi-key:
    • bavyzaluxzfzlv-uhfffaoysa-o
  • molecular-weight:
    • 32.065

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality