Difference between revisions of "METHYLARSONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...") |
(Created page with "Category:metabolite == Metabolite METHYLARSONATE == * common-name: ** methylarsonate * smiles: ** c[as](=o)([o-])o * inchi-key: ** qypprtnmgcreim-uhfffaoysa-m * molecular-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite METHYLARSONATE == |
* common-name: | * common-name: | ||
− | ** | + | ** methylarsonate |
* smiles: | * smiles: | ||
− | ** c | + | ** c[as](=o)([o-])o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qypprtnmgcreim-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 138.962 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2. | + | * [[2.1.1.137-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=methylarsonate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qypprtnmgcreim-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.962}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite METHYLARSONATE
- common-name:
- methylarsonate
- smiles:
- c[as](=o)([o-])o
- inchi-key:
- qypprtnmgcreim-uhfffaoysa-m
- molecular-weight:
- 138.962