Difference between revisions of "METHYLARSONITE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...")
(Created page with "Category:metabolite == Metabolite METHYLARSONITE == * common-name: ** methylarsonite * smiles: ** c[as](o)o * inchi-key: ** oxbirpqqkcqwgv-uhfffaoysa-n * molecular-weight:...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14159 ==
+
== Metabolite METHYLARSONITE ==
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin b
+
** methylarsonite
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+
** c[as](o)o
 
* inchi-key:
 
* inchi-key:
** xcstznjiqfivpe-fqsmhnglsa-s
+
** oxbirpqqkcqwgv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 531.582
+
** 123.971
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.138-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14553]]
 
* [[RXN-15287]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6''-o-carbamoylkanamycin b}}
+
{{#set: common-name=methylarsonite}}
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=oxbirpqqkcqwgv-uhfffaoysa-n}}
{{#set: molecular-weight=531.582}}
+
{{#set: molecular-weight=123.971}}

Latest revision as of 11:14, 18 March 2021

Metabolite METHYLARSONITE

  • common-name:
    • methylarsonite
  • smiles:
    • c[as](o)o
  • inchi-key:
    • oxbirpqqkcqwgv-uhfffaoysa-n
  • molecular-weight:
    • 123.971

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality