Difference between revisions of "METHYLARSONITE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...") |
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SHIKIMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** shikimate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jxohggnkmltubp-hsuxutppsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 173.145 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7968]] | ||
| + | * [[SHIKIMATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] |
| − | * [[RXN | + | * [[SHIKIMATE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=shikimate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jxohggnkmltubp-hsuxutppsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=173.145}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite SHIKIMATE
- common-name:
- shikimate
- smiles:
- c1(=c(cc(c(o)c(o)1)o)c(=o)[o-])
- inchi-key:
- jxohggnkmltubp-hsuxutppsa-m
- molecular-weight:
- 173.145
