Difference between revisions of "METHYLBUT-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
(Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd-uhfffaoysa-n * molecular-weig...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13118 ==
+
== Metabolite METHYLBUT-CPD ==
 
* common-name:
 
* common-name:
** gdp-β-l-fucose
+
** 2-methylbutanal
 
* smiles:
 
* smiles:
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
+
** ccc(c)[ch]=o
 
* inchi-key:
 
* inchi-key:
** lqebexmhblqmdb-jgqubwhwsa-l
+
** bygqbdhughbgmd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 587.33
+
** 86.133
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.221-RXN]]
+
* [[RXN-7694]]
* [[2.4.1.68-RXN]]
 
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
 
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
 
* [[RXN-9463]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.271-RXN]]
 
* [[2.4.1.221-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gdp-β-l-fucose}}
+
{{#set: common-name=2-methylbutanal}}
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
+
{{#set: inchi-key=inchikey=bygqbdhughbgmd-uhfffaoysa-n}}
{{#set: molecular-weight=587.33}}
+
{{#set: molecular-weight=86.133}}

Latest revision as of 11:15, 18 March 2021

Metabolite METHYLBUT-CPD

  • common-name:
    • 2-methylbutanal
  • smiles:
    • ccc(c)[ch]=o
  • inchi-key:
    • bygqbdhughbgmd-uhfffaoysa-n
  • molecular-weight:
    • 86.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality