Difference between revisions of "METHYLBUT-CPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Purine-Ribonucleosides == * common-name: ** a purine ribonucleoside == Reaction(s) known to consume the compound == * PNP-RXN * PUR...") |
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite IDP == |
* common-name: | * common-name: | ||
− | ** | + | ** idp |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** jpxzqmkkfwmmgk-kqynxxcusa-k | ||
+ | * molecular-weight: | ||
+ | ** 425.165 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ADP-DEAMINASE-RXN]] |
− | * [[ | + | * [[ATID]] |
− | * [[RXN- | + | * [[ATIDm]] |
+ | * [[RXN-14003]] | ||
+ | * [[RXN-14120]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADP-DEAMINASE-RXN]] |
+ | * [[ITCY]] | ||
+ | * [[ITUP]] | ||
+ | * [[RXN-14120]] | ||
+ | * [[RXN0-5073]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=idp}} |
+ | {{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}} | ||
+ | {{#set: molecular-weight=425.165}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite IDP
- common-name:
- idp
- smiles:
- c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- jpxzqmkkfwmmgk-kqynxxcusa-k
- molecular-weight:
- 425.165