Difference between revisions of "METHYLBUT-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...")
(Created page with "Category:metabolite == Metabolite CPD-13118 == * common-name: ** gdp-β-l-fucose * smiles: ** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IDP ==
+
== Metabolite CPD-13118 ==
 
* common-name:
 
* common-name:
** idp
+
** gdp-β-l-fucose
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
+
** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
 
* inchi-key:
 
* inchi-key:
** jpxzqmkkfwmmgk-kqynxxcusa-k
+
** lqebexmhblqmdb-jgqubwhwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 425.165
+
** 587.33
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADP-DEAMINASE-RXN]]
+
* [[2.4.1.221-RXN]]
* [[ATID]]
+
* [[2.4.1.68-RXN]]
* [[ATIDm]]
+
* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
* [[RXN-14003]]
+
* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
* [[RXN-14120]]
+
* [[RXN-9463]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADP-DEAMINASE-RXN]]
+
* [[1.1.1.271-RXN]]
* [[ITCY]]
+
* [[2.4.1.221-RXN]]
* [[ITUP]]
 
* [[RXN-14120]]
 
* [[RXN0-5073]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=idp}}
+
{{#set: common-name=gdp-β-l-fucose}}
{{#set: inchi-key=inchikey=jpxzqmkkfwmmgk-kqynxxcusa-k}}
+
{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
{{#set: molecular-weight=425.165}}
+
{{#set: molecular-weight=587.33}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-13118

  • common-name:
    • gdp-β-l-fucose
  • smiles:
    • cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
  • inchi-key:
    • lqebexmhblqmdb-jgqubwhwsa-l
  • molecular-weight:
    • 587.33

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality