Difference between revisions of "METHYLENE-THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14922 == * transcription-direction: ** positive * right-end-position: ** 257461 * left-end-position: ** 255613 * centisome-position: ** 83.89474...") |
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS == * common-name: ** (15s)-hpete * smiles: ** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-] * inchi-key: ** bfwy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS == |
| − | * | + | * common-name: |
| − | ** | + | ** (15s)-hpete |
| − | * | + | * smiles: |
| − | ** | + | ** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** bfwytordsfivkp-vaeksgalsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 335.462 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[ARACHIDONATE-15-LIPOXYGENASE-RXN]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=(15s)-hpete}} | |
| − | + | {{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}} | |
| − | {{#set: | + | {{#set: molecular-weight=335.462}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS
- common-name:
- (15s)-hpete
- smiles:
- cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
- inchi-key:
- bfwytordsfivkp-vaeksgalsa-m
- molecular-weight:
- 335.462
