Difference between revisions of "MEVALONATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-1-P == * common-name: ** n-acetyl-α-d-glucosamine 1-phosphate * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite CPD-7246 == * common-name: ** n-acetyl-α-d-galactosamine 1-phosphate * smiles: ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o * i...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7246 == |
* common-name: | * common-name: | ||
| − | ** n-acetyl-α-d- | + | ** n-acetyl-α-d-galactosamine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o |
* inchi-key: | * inchi-key: | ||
| − | ** fzljpepaypummr- | + | ** fzljpepaypummr-jajwtyfosa-l |
* molecular-weight: | * molecular-weight: | ||
** 299.174 | ** 299.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13760]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-13760]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=n-acetyl-α-d- | + | {{#set: common-name=n-acetyl-α-d-galactosamine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey=fzljpepaypummr- | + | {{#set: inchi-key=inchikey=fzljpepaypummr-jajwtyfosa-l}} |
{{#set: molecular-weight=299.174}} | {{#set: molecular-weight=299.174}} | ||
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPD-7246
- common-name:
- n-acetyl-α-d-galactosamine 1-phosphate
- smiles:
- cc(nc1(c(o)c(o)c(co)oc(op([o-])(=o)[o-])1))=o
- inchi-key:
- fzljpepaypummr-jajwtyfosa-l
- molecular-weight:
- 299.174
