Difference between revisions of "MEVALONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite MEVALONATE == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] * inchi-key: ** kjtlqquupvsxim-zcfiwibfsa-m * molecular-...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BENZOYLCOA ==
+
== Metabolite MEVALONATE ==
 
* common-name:
 
* common-name:
** benzoyl-coa
+
** (r)-mevalonate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(o)(cco)cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** vevjtunlalkrno-tyhxjlicsa-j
+
** kjtlqquupvsxim-zcfiwibfsa-m
 
* molecular-weight:
 
* molecular-weight:
** 867.61
+
** 147.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2006]]
+
* [[1.1.1.34-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=benzoyl-coa}}
+
{{#set: common-name=(r)-mevalonate}}
{{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}}
+
{{#set: inchi-key=inchikey=kjtlqquupvsxim-zcfiwibfsa-m}}
{{#set: molecular-weight=867.61}}
+
{{#set: molecular-weight=147.15}}

Latest revision as of 11:14, 18 March 2021

Metabolite MEVALONATE

  • common-name:
    • (r)-mevalonate
  • smiles:
    • cc(o)(cco)cc(=o)[o-]
  • inchi-key:
    • kjtlqquupvsxim-zcfiwibfsa-m
  • molecular-weight:
    • 147.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality