Difference between revisions of "MG+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18309 == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine * smiles: ** cc(c)c(c([o-])=o)nc(=o)c([n+])cn...")
(Created page with "Category:metabolite == Metabolite MG+2 == * common-name: ** mg2+ * smiles: ** [mg++] * inchi-key: ** jlvvsxflkojniy-uhfffaoysa-n * molecular-weight: ** 24.305 == Reaction(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18309 ==
+
== Metabolite MG+2 ==
 
* common-name:
 
* common-name:
** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
+
** mg2+
 
* smiles:
 
* smiles:
** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
+
** [mg++]
 
* inchi-key:
 
* inchi-key:
** hcgfosjnuodeoh-rulnzfcnsa-n
+
** jlvvsxflkojniy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 316.313
+
** 24.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-MG+2]]
 +
* [[RXN1F-20]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16991]]
+
* [[ExchangeSeed-MG+2]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}}
+
{{#set: common-name=mg2+}}
{{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}}
+
{{#set: inchi-key=inchikey=jlvvsxflkojniy-uhfffaoysa-n}}
{{#set: molecular-weight=316.313}}
+
{{#set: molecular-weight=24.305}}

Latest revision as of 11:14, 18 March 2021

Metabolite MG+2

  • common-name:
    • mg2+
  • smiles:
    • [mg++]
  • inchi-key:
    • jlvvsxflkojniy-uhfffaoysa-n
  • molecular-weight:
    • 24.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality