Difference between revisions of "MG-PROTOPORPHYRIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * smiles: ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD1F-138 == * common-name: ** gibberellin a12-aldehyde * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-138 == |
* common-name: | * common-name: | ||
− | ** | + | ** gibberellin a12-aldehyde |
* smiles: | * smiles: | ||
− | ** c( | + | ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zctunyrxjklwpy-llcokinksa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 315.431 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN1F-161]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-160]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gibberellin a12-aldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zctunyrxjklwpy-llcokinksa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=315.431}} |
Revision as of 14:53, 5 January 2021
Contents
Metabolite CPD1F-138
- common-name:
- gibberellin a12-aldehyde
- smiles:
- c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
- inchi-key:
- zctunyrxjklwpy-llcokinksa-m
- molecular-weight:
- 315.431