Difference between revisions of "MGLDLCTANA-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)...") |
|||
| Line 1: | Line 1: | ||
| − | == | + | [[Category:metabolite]] |
| − | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] == | |
| + | * common-name: | ||
| + | ** l-methionyl-l-alanine dipeptide | ||
| + | * smiles: | ||
| + | ** cc(c(=o)[o-])nc(=o)c(ccsc)[n+] | ||
| + | * inchi-key: | ||
| + | ** jhkxzylnvjraaj-wdskdsinsa-n | ||
| + | * molecular-weight: | ||
| + | ** 220.286 | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6985]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=l-methionyl-l-alanine dipeptide}} | ||
| + | {{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}} | ||
| + | {{#set: molecular-weight=220.286}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-13390
- common-name:
- l-methionyl-l-alanine dipeptide
- smiles:
- cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
- inchi-key:
- jhkxzylnvjraaj-wdskdsinsa-n
- molecular-weight:
- 220.286
