Difference between revisions of "MGLDLCTANA-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] ==
+== Pathway MGLDLCTANA-PWY ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** l-methionyl-l-alanine dipeptide
+** methylglyoxal degradation vi
-* smiles:
+== Reaction(s) found ==
-** cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
+* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
-** jhkxzylnvjraaj-wdskdsinsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-8641 RXN-8641]
-** 220.286
+* [NoneLACTALDEHYDE-OXI-RXN LACTALDEHYDE-OXI-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-40674}}
-* [[RXN0-6985]]
+{{#set: common-name=methylglyoxal degradation vi}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=l-methionyl-l-alanine dipeptide}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}}
-{{#set: molecular-weight=220.286}}