Difference between revisions of "MGLDLCTANA-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] == * common-name: ** l-methionyl-l-alanine dipeptide * smiles: ** cc(c(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13887 CPD-13887] == * common-name: ** (25s)-26-hydroxycholest-4-en-3-one * smiles: ** cc(co...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13887 CPD-13887] ==
 
* common-name:
 
* common-name:
** l-methionyl-l-alanine dipeptide
+
** (25s)-26-hydroxycholest-4-en-3-one
 
* smiles:
 
* smiles:
** cc(c(=o)[o-])nc(=o)c(ccsc)[n+]
+
** cc(co)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** jhkxzylnvjraaj-wdskdsinsa-n
+
** cxuorugfoxgjny-nyjsjaolsa-n
 
* molecular-weight:
 
* molecular-weight:
** 220.286
+
** 400.643
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6985]]
+
* [[RXN-12850]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12848]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-methionyl-l-alanine dipeptide}}
+
{{#set: common-name=(25s)-26-hydroxycholest-4-en-3-one}}
{{#set: inchi-key=inchikey=jhkxzylnvjraaj-wdskdsinsa-n}}
+
{{#set: inchi-key=inchikey=cxuorugfoxgjny-nyjsjaolsa-n}}
{{#set: molecular-weight=220.286}}
+
{{#set: molecular-weight=400.643}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-13887

  • common-name:
    • (25s)-26-hydroxycholest-4-en-3-one
  • smiles:
    • cc(co)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • cxuorugfoxgjny-nyjsjaolsa-n
  • molecular-weight:
    • 400.643

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality