Difference between revisions of "MI-HEXAKISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-hexanoyl-ACPs == * common-name: ** a 3-oxo-hexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9518 == Reactio...")
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-hexanoyl-ACPs ==
+
== Metabolite MI-HEXAKISPHOSPHATE ==
 
* common-name:
 
* common-name:
** a 3-oxo-hexanoyl-[acp]
+
** phytate
 +
* smiles:
 +
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
 +
* inchi-key:
 +
** imqlkjbteoyosi-gpivlxjgsa-b
 +
* molecular-weight:
 +
** 647.942
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9518]]
+
* [[2.7.1.152-RXN]]
 +
* [[RXN-10971]]
 +
* [[RXN-10972]]
 +
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7186]]
 +
* [[RXN-7241]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9516]]
+
* [[RXN-10964]]
* [[RXN-9648]]
+
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7163]]
 +
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-hexanoyl-[acp]}}
+
{{#set: common-name=phytate}}
 +
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
 +
{{#set: molecular-weight=647.942}}

Latest revision as of 11:15, 18 March 2021

Metabolite MI-HEXAKISPHOSPHATE

  • common-name:
    • phytate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
  • inchi-key:
    • imqlkjbteoyosi-gpivlxjgsa-b
  • molecular-weight:
    • 647.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality