Difference between revisions of "MI-HEXAKISPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-949 RXN0-949] == * direction: ** left-to-right * common-name: ** lipoyl synthase * ec-number:...")
 
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-949 RXN0-949] ==
+
== Metabolite MI-HEXAKISPHOSPHATE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** lipoyl synthase
+
** phytate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.8.1.8 ec-2.8.1.8]
+
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Octanoylated-domains]][c] '''+''' 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''+''' 2 [[Sulfurated-Sulfur-Acceptors]][c] '''=>''' 2 [[CH33ADO]][c] '''+''' 1 [[Lipoyl-Protein-N6-lipoyllysine]][c] '''+''' 2 [[MET]][c] '''+''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[Unsulfurated-Sulfur-Acceptors]][c]
+
** imqlkjbteoyosi-gpivlxjgsa-b
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03663]]
+
** 647.942
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.7.1.152-RXN]]
−
* Gene: [[SJ04393]]
+
* [[RXN-10971]]
−
** Category: [[annotation]]
+
* [[RXN-10972]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10977]]
−
* Gene: [[SJ11692]]
+
* [[RXN-10978]]
−
** Category: [[annotation]]
+
* [[RXN-7186]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-7241]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY0-1275]], lipoate biosynthesis and incorporation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1275 PWY0-1275]
+
* [[RXN-10964]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-10977]]
−
* [[PWY0-501]], lipoate biosynthesis and incorporation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-501 PWY0-501]
+
* [[RXN-10978]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-7163]]
−
* [[PWY-6987]], lipoate biosynthesis and incorporation III (Bacillus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6987 PWY-6987]
+
* [[RXN-7186]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=phytate}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
−
== External links  ==
+
{{#set: molecular-weight=647.942}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16586 16586]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07767 R07767]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=lipoyl synthase}}
 
−
{{#set: ec-number=ec-2.8.1.8}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite MI-HEXAKISPHOSPHATE

  • common-name:
    • phytate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
  • inchi-key:
    • imqlkjbteoyosi-gpivlxjgsa-b
  • molecular-weight:
    • 647.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=MI-HEXAKISPHOSPHATE&oldid=138694"