Difference between revisions of "MN+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...")
(Created page with "Category:metabolite == Metabolite MN+2 == * common-name: ** mn2+ * smiles: ** [mn++] * inchi-key: ** waemqwokjmhjla-uhfffaoysa-n * molecular-weight: ** 54.938 == Reaction(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2123 ==
+
== Metabolite MN+2 ==
 
* common-name:
 
* common-name:
** 3-oxodecanoyl-coa
+
** mn2+
 
* smiles:
 
* smiles:
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** [mn++]
 
* inchi-key:
 
* inchi-key:
** azcvxmaplhsiky-hsjnekgzsa-j
+
** waemqwokjmhjla-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 931.738
+
** 54.938
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACACT4]]
+
* [[3.6.3.35-RXN]]
* [[HACD4h]]
+
* [[ExchangeSeed-MN+2]]
* [[RXN-13617]]
+
* [[TransportSeed-MN+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT4]]
+
* [[3.6.3.35-RXN]]
* [[ACACT4h]]
+
* [[ExchangeSeed-MN+2]]
* [[HACD4h]]
+
* [[TransportSeed-MN+2]]
* [[RXN-12490]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxodecanoyl-coa}}
+
{{#set: common-name=mn2+}}
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=waemqwokjmhjla-uhfffaoysa-n}}
{{#set: molecular-weight=931.738}}
+
{{#set: molecular-weight=54.938}}

Latest revision as of 11:14, 18 March 2021

Metabolite MN+2

  • common-name:
    • mn2+
  • smiles:
    • [mn++]
  • inchi-key:
    • waemqwokjmhjla-uhfffaoysa-n
  • molecular-weight:
    • 54.938

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality