Difference between revisions of "MPBQ"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00067 == * transcription-direction: ** negative * right-end-position: ** 1111016 * left-end-position: ** 1105027 * centisome-position: ** 75.22026...") |
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite MPBQ == |
− | * | + | * common-name: |
− | ** | + | ** 2-methyl-6-phytyl-1,4-benzoquinol |
− | * | + | * smiles: |
− | ** | + | ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c |
− | * | + | * inchi-key: |
− | ** | + | ** gtwcnyrfozkwtl-uofxaseasa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 402.659 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-2542]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-2541]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}} |
− | + | {{#set: molecular-weight=402.659}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MPBQ
- common-name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
- inchi-key:
- gtwcnyrfozkwtl-uofxaseasa-n
- molecular-weight:
- 402.659