Difference between revisions of "MPBQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE == * common-name: ** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
+
== Metabolite MPBQ ==
 
* common-name:
 
* common-name:
** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+
** 2-methyl-6-phytyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
+
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
 
* inchi-key:
 
* inchi-key:
** bjlpwucpfajinb-uaqstnrtsa-l
+
** gtwcnyrfozkwtl-uofxaseasa-n
 
* molecular-weight:
 
* molecular-weight:
** 442.531
+
** 402.659
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.42-RXN]]
+
* [[RXN-2542]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.41-RXN]]
+
* [[RXN-2541]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
+
{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
{{#set: molecular-weight=442.531}}
+
{{#set: molecular-weight=402.659}}

Latest revision as of 11:11, 18 March 2021

Metabolite MPBQ

  • common-name:
    • 2-methyl-6-phytyl-1,4-benzoquinol
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
  • inchi-key:
    • gtwcnyrfozkwtl-uofxaseasa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality