Difference between revisions of "MPBQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02113 == * transcription-direction: ** negative * right-end-position: ** 168268 * left-end-position: ** 157823 * centisome-position: ** 29.03747...")
 
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02113 ==
+
== Metabolite MPBQ ==
* transcription-direction:
+
* common-name:
** negative
+
** 2-methyl-6-phytyl-1,4-benzoquinol
* right-end-position:
+
* smiles:
** 168268
+
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
* left-end-position:
+
* inchi-key:
** 157823
+
** gtwcnyrfozkwtl-uofxaseasa-n
* centisome-position:
+
* molecular-weight:
** 29.03747   
+
** 402.659
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-2542]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.2.1.6-RXN]]
+
* [[RXN-2541]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
{{#set: right-end-position=168268}}
+
{{#set: molecular-weight=402.659}}
{{#set: left-end-position=157823}}
 
{{#set: centisome-position=29.03747    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite MPBQ

  • common-name:
    • 2-methyl-6-phytyl-1,4-benzoquinol
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
  • inchi-key:
    • gtwcnyrfozkwtl-uofxaseasa-n
  • molecular-weight:
    • 402.659

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality