Difference between revisions of "MPBQ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17351 == * smiles: ** cccccc=ccc=ccccccccccc(=o)[a glycerolipid] * common-name: ** a [glycerolipid]-(11z,14z)-icosa-11,14-dienoate ==...") |
(Created page with "Category:metabolite == Metabolite MPBQ == * common-name: ** 2-methyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c * inchi-key:...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MPBQ == |
| + | * common-name: | ||
| + | ** 2-methyl-6-phytyl-1,4-benzoquinol | ||
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c |
| − | * | + | * inchi-key: |
| − | ** | + | ** gtwcnyrfozkwtl-uofxaseasa-n |
| + | * molecular-weight: | ||
| + | ** 402.659 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-2542]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-2541]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}} |
| + | {{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}} | ||
| + | {{#set: molecular-weight=402.659}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MPBQ
- common-name:
- 2-methyl-6-phytyl-1,4-benzoquinol
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
- inchi-key:
- gtwcnyrfozkwtl-uofxaseasa-n
- molecular-weight:
- 402.659
