Difference between revisions of "MPBQ"

Revision as of 14:53, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite SN-GERANYLGERANYLGLYCERYL-1-PHOSPHATE ==
+== Metabolite MPBQ ==
 * common-name:
-** 3-(o-geranylgeranyl)-sn-glycerol 1-phosphate
+** 2-methyl-6-phytyl-1,4-benzoquinol
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)o
+** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c=c(c)c(o)=1))c)c
 * inchi-key:
-** bjlpwucpfajinb-uaqstnrtsa-l
+** gtwcnyrfozkwtl-uofxaseasa-n
 * molecular-weight:
-** 442.531
+** 402.659
 == Reaction(s) known to consume the compound ==
-* [[2.5.1.42-RXN]]
+* [[RXN-2542]]
 == Reaction(s) known to produce the compound ==
-* [[2.5.1.41-RXN]]
+* [[RXN-2541]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-(o-geranylgeranyl)-sn-glycerol 1-phosphate}}
+{{#set: common-name=2-methyl-6-phytyl-1,4-benzoquinol}}
-{{#set: inchi-key=inchikey=bjlpwucpfajinb-uaqstnrtsa-l}}
+{{#set: inchi-key=inchikey=gtwcnyrfozkwtl-uofxaseasa-n}}
-{{#set: molecular-weight=442.531}}
+{{#set: molecular-weight=402.659}}